C10H10OS3 — CID 21479727
3,6-dimethyl-5-methylsulfanylthieno[3,2-b]thiophene-2-carbaldehyde (PubChem CID 21479727) has the molecular formula C10H10OS3 and a molecular weight of 242.39 g/mol. Its IUPAC name is 3,6-dimethyl-5-methylsulfanylthieno[3,2-b]thiophene-2-carbaldehyde.
| Compound Name | 3,6-dimethyl-5-methylsulfanylthieno[3,2-b]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 21479727 |
| Molecular Formula | C10H10OS3 |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 3,6-dimethyl-5-methylsulfanylthieno[3,2-b]thiophene-2-carbaldehyde |
| SMILES | CSc1sc2c(C)c(C=O)sc2c1C |
| InChI | InChI=1S/C10H10OS3/c1-5-7(4-11)13-9-6(2)10(12-3)14-8(5)9/h4H,1-3H3 |
| InChIKey | XDTTZVODMOZOQH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|