C26H34N4O3 — CID 122665130
1-(4,5-dimethyl-2-phenylpyrazol-3-yl)-3-[(1R,3E,5Z,10R)-10-hydroxy-4-(hydroxymethyl)-8,8-dimethyl-7-methylidenecyclodeca-3,5-dien-1-yl]urea (PubChem CID 122665130) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-phenylpyrazol-3-yl)-3-[(1R,3E,5Z,10R)-10-hydroxy-4-(hydroxymethyl)-8,8-dimethyl-7-methylidenecyclodeca-3,5-dien-1-yl]urea.
| Compound Name | 1-(4,5-dimethyl-2-phenylpyrazol-3-yl)-3-[(1R,3E,5Z,10R)-10-hydroxy-4-(hydroxymethyl)-8,8-dimethyl-7-methylidenecyclodeca-3,5-dien-1-yl]urea |
|---|---|
| PubChem CID | 122665130 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 1-(4,5-dimethyl-2-phenylpyrazol-3-yl)-3-[(1R,3E,5Z,10R)-10-hydroxy-4-(hydroxymethyl)-8,8-dimethyl-7-methylidenecyclodeca-3,5-dien-1-yl]urea |
| SMILES | C=C1/C=C/C(CO)=C\C[C@@H](NC(=O)Nc2c(C)c(C)nn2-c2ccccc2)[C@H](O)CC1(C)C |
| InChI | InChI=1S/C26H34N4O3/c1-17-11-12-20(16-31)13-14-22(23(32)15-26(17,4)5)27-25(33)28-24-18(2)19(3)29-30(24)21-9-7-6-8-10-21/h6-13,22-23,31-32H,1,14-16H2,2-5H3,(H2,27,28,33)/b12-11-,20-13+/t22-,23-/m1/s1 |
| InChIKey | XNFXFOMDJBFZQH-RYPVXWPUSA-N |
| XLogP | 4.19 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |