C24H26N4O3 — CID 90169144
1-[(1R,2R)-2-hydroxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea (PubChem CID 90169144) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is 1-[(1R,2R)-2-hydroxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea.
| Compound Name | 1-[(1R,2R)-2-hydroxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 90169144 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 1-[(1R,2R)-2-hydroxy-4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea |
| SMILES | CC1(C)C[C@@H](O)[C@H](NC(=O)Nc2c3c(nn2-c2ccccc2)COC3)c2ccccc21 |
| InChI | InChI=1S/C24H26N4O3/c1-24(2)12-20(29)21(16-10-6-7-11-18(16)24)25-23(30)26-22-17-13-31-14-19(17)27-28(22)15-8-4-3-5-9-15/h3-11,20-21,29H,12-14H2,1-2H3,(H2,25,26,30)/t20-,21-/m1/s1 |
| InChIKey | UBWYEMDJGPPIPP-NHCUHLMSSA-N |
| XLogP | 3.81 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |