C24H36N4O3 — CID 143251152
ethane;1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea (PubChem CID 143251152) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is ethane;1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea.
| Compound Name | ethane;1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 143251152 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | ethane;1-[(2E)-6-methoxyhepta-2,6-dien-3-yl]-3-(2-phenyl-4,6-dihydrofuro[3,4-c]pyrazol-3-yl)urea |
| SMILES | C=C(CC/C(=C\C)NC(=O)Nc1c2c(nn1-c1ccccc1)COC2)OC.CC.CC |
| InChI | InChI=1S/C20H24N4O3.2C2H6/c1-4-15(11-10-14(2)26-3)21-20(25)22-19-17-12-27-13-18(17)23-24(19)16-8-6-5-7-9-16;2*1-2/h4-9H,2,10-13H2,1,3H3,(H2,21,22,25);2*1-2H3/b15-4+;; |
| InChIKey | ORMNKBQDCGJNCG-NWSSSQCHSA-N |
| XLogP | 5.92 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|