C53H33N7 — CID 122665138
6-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine (PubChem CID 122665138) has the molecular formula C53H33N7 and a molecular weight of 767.90 g/mol. Its IUPAC name is 6-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine.
| Compound Name | 6-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine |
|---|---|
| PubChem CID | 122665138 |
| Molecular Formula | C53H33N7 |
| Molecular Weight | 767.90 g/mol |
| Exact Mass | 767.28 |
| IUPAC Name | 6-[3,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]benzo[k]phenanthridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc(-c4nc5ccccc5c5c4ccc4ccccc45)c3)n2)cc1 |
| InChI | InChI=1S/C53H33N7/c1-5-18-35(19-6-1)48-55-49(36-20-7-2-8-21-36)58-52(57-48)40-31-39(47-44-30-29-34-17-13-14-26-42(34)46(44)43-27-15-16-28-45(43)54-47)32-41(33-40)53-59-50(37-22-9-3-10-23-37)56-51(60-53)38-24-11-4-12-25-38/h1-33H |
| InChIKey | WYXOYSGMBMWPFQ-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.90 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|