C25H24FN6OP — CID 122667513
3-[(1S)-1-[[2-fluoro-9-(1-phosphanylethyl)purin-6-yl]amino]ethyl]-8-methyl-2-phenylisoquinolin-1-one (PubChem CID 122667513) has the molecular formula C25H24FN6OP and a molecular weight of 474.48 g/mol. Its IUPAC name is 3-[(1S)-1-[[2-fluoro-9-(1-phosphanylethyl)purin-6-yl]amino]ethyl]-8-methyl-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[[2-fluoro-9-(1-phosphanylethyl)purin-6-yl]amino]ethyl]-8-methyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 122667513 |
| Molecular Formula | C25H24FN6OP |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[(1S)-1-[[2-fluoro-9-(1-phosphanylethyl)purin-6-yl]amino]ethyl]-8-methyl-2-phenylisoquinolin-1-one |
| SMILES | Cc1cccc2cc([C@H](C)Nc3nc(F)nc4c3ncn4C(C)P)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C25H24FN6OP/c1-14-8-7-9-17-12-19(32(24(33)20(14)17)18-10-5-4-6-11-18)15(2)28-22-21-23(30-25(26)29-22)31(13-27-21)16(3)34/h4-13,15-16H,34H2,1-3H3,(H,28,29,30)/t15-,16?/m0/s1 |
| InChIKey | AWRKDEAPIAIWPR-VYRBHSGPSA-N |
| XLogP | 5.14 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|