C29H20F9NO5S — CID 122669083
4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-fluorobenzoic acid (PubChem CID 122669083) has the molecular formula C29H20F9NO5S and a molecular weight of 665.53 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-fluorobenzoic acid.
| Compound Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 122669083 |
| Molecular Formula | C29H20F9NO5S |
| Molecular Weight | 665.53 g/mol |
| Exact Mass | 665.09 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)cc1F |
| InChI | InChI=1S/C29H20F9NO5S/c30-18-4-6-19(7-5-18)45(43,44)26-11-12-39(24(40)16-1-8-20(25(41)42)22(31)14-16)23(26)10-2-15-13-17(3-9-21(15)26)27(32,28(33,34)35)29(36,37)38/h1,3-9,13-14,23H,2,10-12H2,(H,41,42)/t23-,26-/m1/s1 |
| InChIKey | XIACOCZEICGICV-ZEQKJWHPSA-N |
| XLogP | 6.48 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |