C24H25ClN4O5 — CID 122669471
2-[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-chloro-3-cyclopropyloxyphenyl)ethanone (PubChem CID 122669471) has the molecular formula C24H25ClN4O5 and a molecular weight of 484.94 g/mol. Its IUPAC name is 2-[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-chloro-3-cyclopropyloxyphenyl)ethanone.
| Compound Name | 2-[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-chloro-3-cyclopropyloxyphenyl)ethanone |
|---|---|
| PubChem CID | 122669471 |
| Molecular Formula | C24H25ClN4O5 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 2-[(3aR,4R,6S,6aS)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1-(4-chloro-3-cyclopropyloxyphenyl)ethanone |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](n1ccc3c(N)ncnc31)O[C@H]2CC(=O)c1ccc(Cl)c(OC2CC2)c1 |
| InChI | InChI=1S/C24H25ClN4O5/c1-24(2)33-19-18(10-16(30)12-3-6-15(25)17(9-12)31-13-4-5-13)32-23(20(19)34-24)29-8-7-14-21(26)27-11-28-22(14)29/h3,6-9,11,13,18-20,23H,4-5,10H2,1-2H3,(H2,26,27,28)/t18-,19-,20+,23+/m0/s1 |
| InChIKey | LYPWJSWGHNMFKA-XFGYDDDFSA-N |
| XLogP | 3.90 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |