C17H13F6NO6S2 — CID 122672990
[(3R)-3-hydroxy-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-7-yl] trifluoromethanesulfonate (PubChem CID 122672990) has the molecular formula C17H13F6NO6S2 and a molecular weight of 505.41 g/mol. Its IUPAC name is [(3R)-3-hydroxy-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3R)-3-hydroxy-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122672990 |
| Molecular Formula | C17H13F6NO6S2 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | [(3R)-3-hydroxy-1-[3-(trifluoromethyl)phenyl]sulfonyl-3,4-dihydro-2H-quinolin-7-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1C[C@H](O)Cc2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C17H13F6NO6S2/c18-16(19,20)11-2-1-3-14(7-11)31(26,27)24-9-12(25)6-10-4-5-13(8-15(10)24)30-32(28,29)17(21,22)23/h1-5,7-8,12,25H,6,9H2/t12-/m1/s1 |
| InChIKey | UPMXAFHWBVCFQS-GFCCVEGCSA-N |
| XLogP | 3.05 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|