About 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one
3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 122673591) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
Molecular Properties
| Compound Name | 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| PubChem CID | 122673591 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | CN1CCn2ncc(N)c2C1=O |
| InChI | InChI=1S/C7H10N4O/c1-10-2-3-11-6(7(10)12)5(8)4-9-11/h4H,2-3,8H2,1H3 |
| InChIKey | GYXPNPAOECXFBX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The IUPAC name of 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (CID 122673591) is 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
What is the SMILES notation for 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The canonical SMILES for 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one is CN1CCn2ncc(N)c2C1=O.
What is the InChIKey of 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
The InChIKey is GYXPNPAOECXFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-10-2-3-11-6(7(10)12)5(8)4-9-11/h4H,2-3,8H2,1H3.
What are the key properties of 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one?
3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one has a molecular weight of 166.18 g/mol, XLogP of -0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-methyl-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one is sourced from PubChem (CID 122673591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).