C12H12ClNO3 — CID 122674358
(2R)-2-[(S)-(6-chloro-5-methyl-3-pyridinyl)-hydroxymethyl]pent-4-ynoic acid (PubChem CID 122674358) has the molecular formula C12H12ClNO3 and a molecular weight of 253.68 g/mol. Its IUPAC name is (2R)-2-[(S)-(6-chloro-5-methyl-3-pyridinyl)-hydroxymethyl]pent-4-ynoic acid.
| Compound Name | (2R)-2-[(S)-(6-chloro-5-methyl-3-pyridinyl)-hydroxymethyl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 122674358 |
| Molecular Formula | C12H12ClNO3 |
| Molecular Weight | 253.68 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (2R)-2-[(S)-(6-chloro-5-methyl-3-pyridinyl)-hydroxymethyl]pent-4-ynoic acid |
| SMILES | C#CC[C@@H](C(=O)O)[C@H](O)c1cnc(Cl)c(C)c1 |
| InChI | InChI=1S/C12H12ClNO3/c1-3-4-9(12(16)17)10(15)8-5-7(2)11(13)14-6-8/h1,5-6,9-10,15H,4H2,2H3,(H,16,17)/t9-,10-/m1/s1 |
| InChIKey | IOSBNRRRLYQBNM-NXEZZACHSA-N |
| XLogP | 1.80 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|