C6H12FN — CID 122674591
(Z,2S)-3-fluoro-N-methylpent-3-en-2-amine (PubChem CID 122674591) has the molecular formula C6H12FN and a molecular weight of 117.17 g/mol. Its IUPAC name is (Z,2S)-3-fluoro-N-methylpent-3-en-2-amine.
| Compound Name | (Z,2S)-3-fluoro-N-methylpent-3-en-2-amine |
|---|---|
| PubChem CID | 122674591 |
| Molecular Formula | C6H12FN |
| Molecular Weight | 117.17 g/mol |
| Exact Mass | 117.10 |
| IUPAC Name | (Z,2S)-3-fluoro-N-methylpent-3-en-2-amine |
| SMILES | C/C=C(\F)[C@H](C)NC |
| InChI | InChI=1S/C6H12FN/c1-4-6(7)5(2)8-3/h4-5,8H,1-3H3/b6-4-/t5-/m0/s1 |
| InChIKey | VIMMBEOJJUMLFE-YIWIKUPCSA-N |
| XLogP | 1.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |