C23H25F4N — CID 122675907
9b-[(4-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole (PubChem CID 122675907) has the molecular formula C23H25F4N and a molecular weight of 391.45 g/mol. Its IUPAC name is 9b-[(4-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole.
| Compound Name | 9b-[(4-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
|---|---|
| PubChem CID | 122675907 |
| Molecular Formula | C23H25F4N |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 9b-[(4-methylphenyl)methyl]-7-(1,1,1,2-tetrafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrobenzo[e]indole |
| SMILES | Cc1ccc(CC23CCNC2CCc2cc(C(C)(F)C(F)(F)F)ccc23)cc1 |
| InChI | InChI=1S/C23H25F4N/c1-15-3-5-16(6-4-15)14-22-11-12-28-20(22)10-7-17-13-18(8-9-19(17)22)21(2,24)23(25,26)27/h3-6,8-9,13,20,28H,7,10-12,14H2,1-2H3 |
| InChIKey | XYIQJZSDLJLNSD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |