C22H26N2 — CID 122679538
2-benzyl-1-methyl-7-propyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 122679538) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-benzyl-1-methyl-7-propyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-benzyl-1-methyl-7-propyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 122679538 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 2-benzyl-1-methyl-7-propyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCc1ccc2c3c([nH]c2c1)C(C)N(Cc1ccccc1)CC3 |
| InChI | InChI=1S/C22H26N2/c1-3-7-17-10-11-19-20-12-13-24(15-18-8-5-4-6-9-18)16(2)22(20)23-21(19)14-17/h4-6,8-11,14,16,23H,3,7,12-13,15H2,1-2H3 |
| InChIKey | LEMAPWGLTJSNGF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|