C58H43N7 — CID 122683227
9-[4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-5-(N-phenylanilino)indol-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylcarbazol-3-amine (PubChem CID 122683227) has the molecular formula C58H43N7 and a molecular weight of 838.03 g/mol. Its IUPAC name is 9-[4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-5-(N-phenylanilino)indol-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylcarbazol-3-amine.
| Compound Name | 9-[4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-5-(N-phenylanilino)indol-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylcarbazol-3-amine |
|---|---|
| PubChem CID | 122683227 |
| Molecular Formula | C58H43N7 |
| Molecular Weight | 838.03 g/mol |
| Exact Mass | 837.36 |
| IUPAC Name | 9-[4-[3-[(1Z)-buta-1,3-dienyl]-2-methyl-5-(N-phenylanilino)indol-1-yl]-6-phenyl-1,3,5-triazin-2-yl]-N,N-diphenylcarbazol-3-amine |
| SMILES | C=C/C=C\c1c(C)n(-c2nc(-c3ccccc3)nc(-n3c4ccccc4c4cc(N(c5ccccc5)c5ccccc5)ccc43)n2)c2ccc(N(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C58H43N7/c1-3-4-32-49-41(2)62(54-37-35-47(39-51(49)54)63(43-24-12-6-13-25-43)44-26-14-7-15-27-44)57-59-56(42-22-10-5-11-23-42)60-58(61-57)65-53-34-21-20-33-50(53)52-40-48(36-38-55(52)65)64(45-28-16-8-17-29-45)46-30-18-9-19-31-46/h3-40H,1H2,2H3/b32-4- |
| InChIKey | DWQREHAXACGVJS-PCXLXRRESA-N |
| XLogP | 15.03 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.03 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|