C46H31N5O — CID 170124774
9-[4-[6-[3-[(1Z)-buta-1,3-dienyl]-2-methylindol-1-yl]dibenzofuran-2-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole (PubChem CID 170124774) has the molecular formula C46H31N5O and a molecular weight of 669.79 g/mol. Its IUPAC name is 9-[4-[6-[3-[(1Z)-buta-1,3-dienyl]-2-methylindol-1-yl]dibenzofuran-2-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-[6-[3-[(1Z)-buta-1,3-dienyl]-2-methylindol-1-yl]dibenzofuran-2-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 170124774 |
| Molecular Formula | C46H31N5O |
| Molecular Weight | 669.79 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 9-[4-[6-[3-[(1Z)-buta-1,3-dienyl]-2-methylindol-1-yl]dibenzofuran-2-yl]-6-phenyl-1,3,5-triazin-2-yl]carbazole |
| SMILES | C=C/C=C\c1c(C)n(-c2cccc3c2oc2ccc(-c4nc(-c5ccccc5)nc(-n5c6ccccc6c6ccccc65)n4)cc23)c2ccccc12 |
| InChI | InChI=1S/C46H31N5O/c1-3-4-17-32-29(2)50(38-22-11-8-18-33(32)38)41-25-14-21-36-37-28-31(26-27-42(37)52-43(36)41)45-47-44(30-15-6-5-7-16-30)48-46(49-45)51-39-23-12-9-19-34(39)35-20-10-13-24-40(35)51/h3-28H,1H2,2H3/b17-4- |
| InChIKey | ZKHVXCJLFMYVFA-INGKJJEOSA-N |
| XLogP | 11.65 |
| TPSA | 61.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.79 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|