C52H34N4S2 — CID 170086967
3-[(1Z)-buta-1,3-dienyl]-1-[9-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]dibenzothiophen-1-yl]-2-methylindole (PubChem CID 170086967) has the molecular formula C52H34N4S2 and a molecular weight of 779.01 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-[9-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]dibenzothiophen-1-yl]-2-methylindole.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-[9-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]dibenzothiophen-1-yl]-2-methylindole |
|---|---|
| PubChem CID | 170086967 |
| Molecular Formula | C52H34N4S2 |
| Molecular Weight | 779.01 g/mol |
| Exact Mass | 778.22 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-[9-[8-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-3-yl]dibenzothiophen-1-yl]-2-methylindole |
| SMILES | C=C/C=C\c1c(C)n(-c2cccc3sc4cccc(-c5ccc6c(c5)sc5ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc56)c4c23)c2ccccc12 |
| InChI | InChI=1S/C52H34N4S2/c1-3-4-19-37-32(2)56(42-22-12-11-20-39(37)42)43-23-14-25-46-49(43)48-38(21-13-24-45(48)58-46)35-26-28-40-41-30-36(27-29-44(41)57-47(40)31-35)52-54-50(33-15-7-5-8-16-33)53-51(55-52)34-17-9-6-10-18-34/h3-31H,1H2,2H3/b19-4- |
| InChIKey | LCUPJNYQCCBYBH-PVOVUMCXSA-N |
| XLogP | 14.73 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.01 |
| LogP ≤ 5 | 14.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|