C30H33N7O3S — CID 122686365
4-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-4-oxido-1,4-thiazinan-4-ium 1-oxide (PubChem CID 122686365) has the molecular formula C30H33N7O3S and a molecular weight of 571.71 g/mol. Its IUPAC name is 4-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-4-oxido-1,4-thiazinan-4-ium 1-oxide.
| Compound Name | 4-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-4-oxido-1,4-thiazinan-4-ium 1-oxide |
|---|---|
| PubChem CID | 122686365 |
| Molecular Formula | C30H33N7O3S |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 4-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]-4-oxido-1,4-thiazinan-4-ium 1-oxide |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc([N+]4([O-])CCS(=O)CC4)nc3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C30H33N7O3S/c1-20-28(35(2)34-33-20)23-18-25-27(31-19-23)24-8-9-26(37(38)12-16-41(39)17-13-37)32-30(24)36(25)29(21-6-4-3-5-7-21)22-10-14-40-15-11-22/h3-9,18-19,22,29H,10-17H2,1-2H3/t29-,37?,41?/m1/s1 |
| InChIKey | WYWPSMAJHLZEQL-JELKXEOTSA-N |
| XLogP | 4.27 |
| TPSA | 110.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|