C28H30N6O2 — CID 122687065
1-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethanol (PubChem CID 122687065) has the molecular formula C28H30N6O2 and a molecular weight of 482.59 g/mol. Its IUPAC name is 1-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethanol.
| Compound Name | 1-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethanol |
|---|---|
| PubChem CID | 122687065 |
| Molecular Formula | C28H30N6O2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-[5-(3,5-dimethyltriazol-4-yl)-8-[(S)-oxan-4-yl(phenyl)methyl]-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl]ethanol |
| SMILES | Cc1nnn(C)c1-c1cnc2c3ccc(C(C)O)nc3n([C@H](c3ccccc3)C3CCOCC3)c2c1 |
| InChI | InChI=1S/C28H30N6O2/c1-17-26(33(3)32-31-17)21-15-24-25(29-16-21)22-9-10-23(18(2)35)30-28(22)34(24)27(19-7-5-4-6-8-19)20-11-13-36-14-12-20/h4-10,15-16,18,20,27,35H,11-14H2,1-3H3/t18?,27-/m1/s1 |
| InChIKey | FQUBFNRRLAFJTG-MKAWVKDUSA-N |
| XLogP | 4.76 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |