C29H24N6O — CID 122689216
N-[(S)-(6-methoxy-3-pyridinyl)-pyridin-3-ylmethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine (PubChem CID 122689216) has the molecular formula C29H24N6O and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[(S)-(6-methoxy-3-pyridinyl)-pyridin-3-ylmethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine.
| Compound Name | N-[(S)-(6-methoxy-3-pyridinyl)-pyridin-3-ylmethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689216 |
| Molecular Formula | C29H24N6O |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-[(S)-(6-methoxy-3-pyridinyl)-pyridin-3-ylmethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
| SMILES | COc1ccc([C@@H](Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)c2cccnc2)cn1 |
| InChI | InChI=1S/C29H24N6O/c1-35-13-9-19-5-6-20(14-26(19)35)24-15-23(16-25-29(24)32-12-11-31-25)34-28(21-4-3-10-30-17-21)22-7-8-27(36-2)33-18-22/h3-18,28,34H,1-2H3/t28-/m0/s1 |
| InChIKey | XBBUJUUODZDTIM-NDEPHWFRSA-N |
| XLogP | 5.79 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|