C28H25F3N6O2 — CID 133053811
8-(6-methoxy-3-pyridinyl)-3-methyl-1-[4-[3-(trifluoromethyl)piperazin-1-yl]phenyl]imidazo[4,5-c]quinolin-2-one (PubChem CID 133053811) has the molecular formula C28H25F3N6O2 and a molecular weight of 534.54 g/mol. Its IUPAC name is 8-(6-methoxy-3-pyridinyl)-3-methyl-1-[4-[3-(trifluoromethyl)piperazin-1-yl]phenyl]imidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-(6-methoxy-3-pyridinyl)-3-methyl-1-[4-[3-(trifluoromethyl)piperazin-1-yl]phenyl]imidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 133053811 |
| Molecular Formula | C28H25F3N6O2 |
| Molecular Weight | 534.54 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 8-(6-methoxy-3-pyridinyl)-3-methyl-1-[4-[3-(trifluoromethyl)piperazin-1-yl]phenyl]imidazo[4,5-c]quinolin-2-one |
| SMILES | COc1ccc(-c2ccc3ncc4c(c3c2)n(-c2ccc(N3CCNC(C(F)(F)F)C3)cc2)c(=O)n4C)cn1 |
| InChI | InChI=1S/C28H25F3N6O2/c1-35-23-15-33-22-9-3-17(18-4-10-25(39-2)34-14-18)13-21(22)26(23)37(27(35)38)20-7-5-19(6-8-20)36-12-11-32-24(16-36)28(29,30)31/h3-10,13-15,24,32H,11-12,16H2,1-2H3 |
| InChIKey | OZZKIDQZIPMFBM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|