C22H19N5O3S — CID 122690807
4-methyl-2-[7-[(4-methylsulfonyl-3-pyridinyl)amino]quinoxalin-5-yl]benzamide (PubChem CID 122690807) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is 4-methyl-2-[7-[(4-methylsulfonyl-3-pyridinyl)amino]quinoxalin-5-yl]benzamide.
| Compound Name | 4-methyl-2-[7-[(4-methylsulfonyl-3-pyridinyl)amino]quinoxalin-5-yl]benzamide |
|---|---|
| PubChem CID | 122690807 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-methyl-2-[7-[(4-methylsulfonyl-3-pyridinyl)amino]quinoxalin-5-yl]benzamide |
| SMILES | Cc1ccc(C(N)=O)c(-c2cc(Nc3cnccc3S(C)(=O)=O)cc3nccnc23)c1 |
| InChI | InChI=1S/C22H19N5O3S/c1-13-3-4-15(22(23)28)16(9-13)17-10-14(11-18-21(17)26-8-7-25-18)27-19-12-24-6-5-20(19)31(2,29)30/h3-12,27H,1-2H3,(H2,23,28) |
| InChIKey | WUVCHESSDGWUPP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 127.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |