C26H22N4O4S — CID 122690582
methyl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-4-methylsulfonylbenzoate (PubChem CID 122690582) has the molecular formula C26H22N4O4S and a molecular weight of 486.55 g/mol. Its IUPAC name is methyl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-4-methylsulfonylbenzoate.
| Compound Name | methyl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 122690582 |
| Molecular Formula | C26H22N4O4S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | methyl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-4-methylsulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(C)(=O)=O)c(Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)c1 |
| InChI | InChI=1S/C26H22N4O4S/c1-30-11-8-16-4-5-17(13-23(16)30)20-14-19(15-22-25(20)28-10-9-27-22)29-21-12-18(26(31)34-2)6-7-24(21)35(3,32)33/h4-15,29H,1-3H3 |
| InChIKey | LBUXYRHPDNDGTN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|