C27H21N7 — CID 122689414
8-(1-methylindol-6-yl)-N-[(5-pyrimidin-5-yl-3-pyridinyl)methyl]quinoxalin-6-amine (PubChem CID 122689414) has the molecular formula C27H21N7 and a molecular weight of 443.51 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-[(5-pyrimidin-5-yl-3-pyridinyl)methyl]quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-[(5-pyrimidin-5-yl-3-pyridinyl)methyl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689414 |
| Molecular Formula | C27H21N7 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-[(5-pyrimidin-5-yl-3-pyridinyl)methyl]quinoxalin-6-amine |
| SMILES | Cn1ccc2ccc(-c3cc(NCc4cncc(-c5cncnc5)c4)cc4nccnc34)cc21 |
| InChI | InChI=1S/C27H21N7/c1-34-7-4-19-2-3-20(9-26(19)34)24-10-23(11-25-27(24)32-6-5-31-25)33-13-18-8-21(14-28-12-18)22-15-29-17-30-16-22/h2-12,14-17,33H,13H2,1H3 |
| InChIKey | UMNCRIMBDHNYBZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|