C22H20N6 — CID 122688976
8-(1-methylindol-6-yl)-N-[(2-methylpyrazol-3-yl)methyl]quinoxalin-6-amine (PubChem CID 122688976) has the molecular formula C22H20N6 and a molecular weight of 368.44 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-[(2-methylpyrazol-3-yl)methyl]quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-[(2-methylpyrazol-3-yl)methyl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 122688976 |
| Molecular Formula | C22H20N6 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-[(2-methylpyrazol-3-yl)methyl]quinoxalin-6-amine |
| SMILES | Cn1nccc1CNc1cc(-c2ccc3ccn(C)c3c2)c2nccnc2c1 |
| InChI | InChI=1S/C22H20N6/c1-27-10-6-15-3-4-16(11-21(15)27)19-12-17(13-20-22(19)24-9-8-23-20)25-14-18-5-7-26-28(18)2/h3-13,25H,14H2,1-2H3 |
| InChIKey | GQAMQMWFBQHFPA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|