C26H24N8 — CID 134509286
N-[(R)-(3-methylimidazol-4-yl)-(1-methylpyrazol-4-yl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine (PubChem CID 134509286) has the molecular formula C26H24N8 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[(R)-(3-methylimidazol-4-yl)-(1-methylpyrazol-4-yl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine.
| Compound Name | N-[(R)-(3-methylimidazol-4-yl)-(1-methylpyrazol-4-yl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 134509286 |
| Molecular Formula | C26H24N8 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[(R)-(3-methylimidazol-4-yl)-(1-methylpyrazol-4-yl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
| SMILES | Cn1cc([C@@H](Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)c2cncn2C)cn1 |
| InChI | InChI=1S/C26H24N8/c1-32-9-6-17-4-5-18(10-23(17)32)21-11-20(12-22-26(21)29-8-7-28-22)31-25(19-13-30-34(3)15-19)24-14-27-16-33(24)2/h4-16,25,31H,1-3H3/t25-/m1/s1 |
| InChIKey | RMBDRWCPHIFSER-RUZDIDTESA-N |
| XLogP | 4.46 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|