C27H26N4O — CID 122689360
N-[(1R)-1-(3-ethoxyphenyl)ethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine (PubChem CID 122689360) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is N-[(1R)-1-(3-ethoxyphenyl)ethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine.
| Compound Name | N-[(1R)-1-(3-ethoxyphenyl)ethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689360 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[(1R)-1-(3-ethoxyphenyl)ethyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine |
| SMILES | CCOc1cccc([C@@H](C)Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)c1 |
| InChI | InChI=1S/C27H26N4O/c1-4-32-23-7-5-6-20(14-23)18(2)30-22-16-24(27-25(17-22)28-11-12-29-27)21-9-8-19-10-13-31(3)26(19)15-21/h5-18,30H,4H2,1-3H3/t18-/m1/s1 |
| InChIKey | ZJNDOMMCEUNAGG-GOSISDBHSA-N |
| XLogP | 6.36 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|