C24H21N5 — CID 122689144
8-(1-methylindol-6-yl)-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine (PubChem CID 122689144) has the molecular formula C24H21N5 and a molecular weight of 379.47 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689144 |
| Molecular Formula | C24H21N5 |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine |
| SMILES | CC(Nc1cc(-c2ccc3ccn(C)c3c2)c2nccnc2c1)c1cccnc1 |
| InChI | InChI=1S/C24H21N5/c1-16(19-4-3-8-25-15-19)28-20-13-21(24-22(14-20)26-9-10-27-24)18-6-5-17-7-11-29(2)23(17)12-18/h3-16,28H,1-2H3 |
| InChIKey | LPLAHTIXWYCFLA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|