C28H36N6 — CID 145185350
8-[3-(3-aminoazetidin-1-yl)phenyl]-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine;ethane (PubChem CID 145185350) has the molecular formula C28H36N6 and a molecular weight of 456.64 g/mol. Its IUPAC name is 8-[3-(3-aminoazetidin-1-yl)phenyl]-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine;ethane.
| Compound Name | 8-[3-(3-aminoazetidin-1-yl)phenyl]-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine;ethane |
|---|---|
| PubChem CID | 145185350 |
| Molecular Formula | C28H36N6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 8-[3-(3-aminoazetidin-1-yl)phenyl]-N-(1-pyridin-3-ylethyl)quinoxalin-6-amine;ethane |
| SMILES | CC.CC.CC(Nc1cc(-c2cccc(N3CC(N)C3)c2)c2nccnc2c1)c1cccnc1 |
| InChI | InChI=1S/C24H24N6.2C2H6/c1-16(18-5-3-7-26-13-18)29-20-11-22(24-23(12-20)27-8-9-28-24)17-4-2-6-21(10-17)30-14-19(25)15-30;2*1-2/h2-13,16,19,29H,14-15,25H2,1H3;2*1-2H3 |
| InChIKey | IGACQMPYHTXVTR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |