C27H31N5S — CID 145185016
ethane;4-[7-[[piperidin-4-yl(pyridin-3-yl)methyl]amino]quinoxalin-5-yl]benzenethiol (PubChem CID 145185016) has the molecular formula C27H31N5S and a molecular weight of 457.65 g/mol. Its IUPAC name is ethane;4-[7-[[piperidin-4-yl(pyridin-3-yl)methyl]amino]quinoxalin-5-yl]benzenethiol.
| Compound Name | ethane;4-[7-[[piperidin-4-yl(pyridin-3-yl)methyl]amino]quinoxalin-5-yl]benzenethiol |
|---|---|
| PubChem CID | 145185016 |
| Molecular Formula | C27H31N5S |
| Molecular Weight | 457.65 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | ethane;4-[7-[[piperidin-4-yl(pyridin-3-yl)methyl]amino]quinoxalin-5-yl]benzenethiol |
| SMILES | CC.Sc1ccc(-c2cc(NC(c3cccnc3)C3CCNCC3)cc3nccnc23)cc1 |
| InChI | InChI=1S/C25H25N5S.C2H6/c31-21-5-3-17(4-6-21)22-14-20(15-23-25(22)29-13-12-28-23)30-24(18-7-10-26-11-8-18)19-2-1-9-27-16-19;1-2/h1-6,9,12-16,18,24,26,30-31H,7-8,10-11H2;1-2H3 |
| InChIKey | GIDWYDCKOHUFBD-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.65 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|