C26H23N5 — CID 122689341
8-(1-methylindol-6-yl)-N-[(8S)-5,6,7,8-tetrahydroisoquinolin-8-yl]quinoxalin-6-amine (PubChem CID 122689341) has the molecular formula C26H23N5 and a molecular weight of 405.51 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-[(8S)-5,6,7,8-tetrahydroisoquinolin-8-yl]quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-[(8S)-5,6,7,8-tetrahydroisoquinolin-8-yl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689341 |
| Molecular Formula | C26H23N5 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-[(8S)-5,6,7,8-tetrahydroisoquinolin-8-yl]quinoxalin-6-amine |
| SMILES | Cn1ccc2ccc(-c3cc(N[C@H]4CCCc5ccncc54)cc4nccnc34)cc21 |
| InChI | InChI=1S/C26H23N5/c1-31-12-8-18-5-6-19(13-25(18)31)21-14-20(15-24-26(21)29-11-10-28-24)30-23-4-2-3-17-7-9-27-16-22(17)23/h5-16,23,30H,2-4H2,1H3/t23-/m0/s1 |
| InChIKey | ZUVHBLLISPQAFW-QHCPKHFHSA-N |
| XLogP | 5.67 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|