C40H35ClN8O — CID 159012532
7-chloro-5-(1-methylindol-6-yl)quinoxaline;1-[(3R)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidin-1-yl]ethanone (PubChem CID 159012532) has the molecular formula C40H35ClN8O and a molecular weight of 679.23 g/mol. Its IUPAC name is 7-chloro-5-(1-methylindol-6-yl)quinoxaline;1-[(3R)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidin-1-yl]ethanone.
| Compound Name | 7-chloro-5-(1-methylindol-6-yl)quinoxaline;1-[(3R)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 159012532 |
| Molecular Formula | C40H35ClN8O |
| Molecular Weight | 679.23 g/mol |
| Exact Mass | 678.26 |
| IUPAC Name | 7-chloro-5-(1-methylindol-6-yl)quinoxaline;1-[(3R)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@@H](Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)C1.Cn1ccc2ccc(-c3cc(Cl)cc4nccnc34)cc21 |
| InChI | InChI=1S/C23H23N5O.C17H12ClN3/c1-15(29)28-10-6-18(14-28)26-19-12-20(23-21(13-19)24-7-8-25-23)17-4-3-16-5-9-27(2)22(16)11-17;1-21-7-4-11-2-3-12(8-16(11)21)14-9-13(18)10-15-17(14)20-6-5-19-15/h3-5,7-9,11-13,18,26H,6,10,14H2,1-2H3;2-10H,1H3/t18-;/m1./s1 |
| InChIKey | JSRDXZWUAXFHCN-GMUIIQOCSA-N |
| XLogP | 8.26 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.23 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|