C26H29N5O2 — CID 145185179
6-(cyclopentylamino)-8-(1-methylindol-6-yl)quinoxaline-2-carboxamide;propan-2-one (PubChem CID 145185179) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-(cyclopentylamino)-8-(1-methylindol-6-yl)quinoxaline-2-carboxamide;propan-2-one.
| Compound Name | 6-(cyclopentylamino)-8-(1-methylindol-6-yl)quinoxaline-2-carboxamide;propan-2-one |
|---|---|
| PubChem CID | 145185179 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6-(cyclopentylamino)-8-(1-methylindol-6-yl)quinoxaline-2-carboxamide;propan-2-one |
| SMILES | CC(C)=O.Cn1ccc2ccc(-c3cc(NC4CCCC4)cc4ncc(C(N)=O)nc34)cc21 |
| InChI | InChI=1S/C23H23N5O.C3H6O/c1-28-9-8-14-6-7-15(10-21(14)28)18-11-17(26-16-4-2-3-5-16)12-19-22(18)27-20(13-25-19)23(24)29;1-3(2)4/h6-13,16,26H,2-5H2,1H3,(H2,24,29);1-2H3 |
| InChIKey | MMEMZTHHDVFNTL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|