C27H31N5O2 — CID 145185187
2-methylbutan-2-yl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 145185187) has the molecular formula C27H31N5O2 and a molecular weight of 457.58 g/mol. Its IUPAC name is 2-methylbutan-2-yl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145185187 |
| Molecular Formula | C27H31N5O2 |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | 2-methylbutan-2-yl 3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)C1 |
| InChI | InChI=1S/C27H31N5O2/c1-5-27(2,3)34-26(33)32-13-9-20(17-32)30-21-15-22(25-23(16-21)28-10-11-29-25)19-7-6-18-8-12-31(4)24(18)14-19/h6-8,10-12,14-16,20,30H,5,9,13,17H2,1-4H3 |
| InChIKey | QTXZJQYORIEBKH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|