C28H28N6O — CID 175860526
1-[3-[[3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-2H-pyridin-1-yl]methyl]azetidin-1-yl]ethanone (PubChem CID 175860526) has the molecular formula C28H28N6O and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[3-[[3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-2H-pyridin-1-yl]methyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[[3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-2H-pyridin-1-yl]methyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 175860526 |
| Molecular Formula | C28H28N6O |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[3-[[3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]-2H-pyridin-1-yl]methyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(CN2C=CC=C(Nc3cc(-c4ccc5ccn(C)c5c4)c4nccnc4c3)C2)C1 |
| InChI | InChI=1S/C28H28N6O/c1-19(35)34-16-20(17-34)15-33-10-3-4-23(18-33)31-24-13-25(28-26(14-24)29-8-9-30-28)22-6-5-21-7-11-32(2)27(21)12-22/h3-14,20,31H,15-18H2,1-2H3 |
| InChIKey | QFKQAQFUXQGYBH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|