C28H30N6 — CID 175860569
8-(1-methylindol-6-yl)-N-[1-(1-methylpiperidin-3-yl)-2H-pyridin-3-yl]quinoxalin-6-amine (PubChem CID 175860569) has the molecular formula C28H30N6 and a molecular weight of 450.59 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-[1-(1-methylpiperidin-3-yl)-2H-pyridin-3-yl]quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-[1-(1-methylpiperidin-3-yl)-2H-pyridin-3-yl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 175860569 |
| Molecular Formula | C28H30N6 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-[1-(1-methylpiperidin-3-yl)-2H-pyridin-3-yl]quinoxalin-6-amine |
| SMILES | CN1CCCC(N2C=CC=C(Nc3cc(-c4ccc5ccn(C)c5c4)c4nccnc4c3)C2)C1 |
| InChI | InChI=1S/C28H30N6/c1-32-12-4-6-24(19-32)34-13-3-5-22(18-34)31-23-16-25(28-26(17-23)29-10-11-30-28)21-8-7-20-9-14-33(2)27(20)15-21/h3,5,7-11,13-17,24,31H,4,6,12,18-19H2,1-2H3 |
| InChIKey | ZDSKRWZMYLBTLC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|