C30H29N7O2 — CID 122690595
N-(1-acetylpiperidin-3-yl)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyridine-4-carboxamide (PubChem CID 122690595) has the molecular formula C30H29N7O2 and a molecular weight of 519.61 g/mol. Its IUPAC name is N-(1-acetylpiperidin-3-yl)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyridine-4-carboxamide.
| Compound Name | N-(1-acetylpiperidin-3-yl)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 122690595 |
| Molecular Formula | C30H29N7O2 |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | N-(1-acetylpiperidin-3-yl)-3-[[8-(1-methylindol-6-yl)quinoxalin-6-yl]amino]pyridine-4-carboxamide |
| SMILES | CC(=O)N1CCCC(NC(=O)c2ccncc2Nc2cc(-c3ccc4ccn(C)c4c3)c3nccnc3c2)C1 |
| InChI | InChI=1S/C30H29N7O2/c1-19(38)37-12-3-4-22(18-37)35-30(39)24-7-9-31-17-27(24)34-23-15-25(29-26(16-23)32-10-11-33-29)21-6-5-20-8-13-36(2)28(20)14-21/h5-11,13-17,22,34H,3-4,12,18H2,1-2H3,(H,35,39) |
| InChIKey | LMTJCDVVVWIRJI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|