C25H24N4O — CID 122689251
8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine (PubChem CID 122689251) has the molecular formula C25H24N4O and a molecular weight of 396.49 g/mol. Its IUPAC name is 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine.
| Compound Name | 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689251 |
| Molecular Formula | C25H24N4O |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine |
| SMILES | COc1ccc(-c2cc(N[C@@H]3CCCc4ccccc43)cc3nccnc23)cc1N |
| InChI | InChI=1S/C25H24N4O/c1-30-24-10-9-17(13-21(24)26)20-14-18(15-23-25(20)28-12-11-27-23)29-22-8-4-6-16-5-2-3-7-19(16)22/h2-3,5,7,9-15,22,29H,4,6,8,26H2,1H3/t22-/m1/s1 |
| InChIKey | IGGAHQHZTCBGJE-JOCHJYFZSA-N |
| XLogP | 5.38 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|