C27H24N4 — CID 122689430
8-(1-methylindol-6-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine (PubChem CID 122689430) has the molecular formula C27H24N4 and a molecular weight of 404.52 g/mol. Its IUPAC name is 8-(1-methylindol-6-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine.
| Compound Name | 8-(1-methylindol-6-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 122689430 |
| Molecular Formula | C27H24N4 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 8-(1-methylindol-6-yl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine |
| SMILES | Cn1ccc2ccc(-c3cc(N[C@@H]4CCCc5ccccc54)cc4nccnc34)cc21 |
| InChI | InChI=1S/C27H24N4/c1-31-14-11-19-9-10-20(15-26(19)31)23-16-21(17-25-27(23)29-13-12-28-25)30-24-8-4-6-18-5-2-3-7-22(18)24/h2-3,5,7,9-17,24,30H,4,6,8H2,1H3/t24-/m1/s1 |
| InChIKey | FJFJMTVXPRWXNX-XMMPIXPASA-N |
| XLogP | 6.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|