C48H48N8O2 — CID 159167577
8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-(oxan-3-ylmethyl)quinoxalin-6-amine (PubChem CID 159167577) has the molecular formula C48H48N8O2 and a molecular weight of 768.97 g/mol. Its IUPAC name is 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-(oxan-3-ylmethyl)quinoxalin-6-amine.
| Compound Name | 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-(oxan-3-ylmethyl)quinoxalin-6-amine |
|---|---|
| PubChem CID | 159167577 |
| Molecular Formula | C48H48N8O2 |
| Molecular Weight | 768.97 g/mol |
| Exact Mass | 768.39 |
| IUPAC Name | 8-(3-amino-4-methoxyphenyl)-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-(oxan-3-ylmethyl)quinoxalin-6-amine |
| SMILES | COc1ccc(-c2cc(N[C@@H]3CCCc4ccccc43)cc3nccnc23)cc1N.Cn1ccc2ccc(-c3cc(NCC4CCCOC4)cc4nccnc34)cc21 |
| InChI | InChI=1S/C25H24N4O.C23H24N4O/c1-30-24-10-9-17(13-21(24)26)20-14-18(15-23-25(20)28-12-11-27-23)29-22-8-4-6-16-5-2-3-7-19(16)22;1-27-9-6-17-4-5-18(11-22(17)27)20-12-19(13-21-23(20)25-8-7-24-21)26-14-16-3-2-10-28-15-16/h2-3,5,7,9-15,22,29H,4,6,8,26H2,1H3;4-9,11-13,16,26H,2-3,10,14-15H2,1H3/t22-;/m1./s1 |
| InChIKey | KLGQBYQCBKLRCP-VZYDHVRKSA-N |
| XLogP | 10.00 |
| TPSA | 125.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.97 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|