C13H15N3 — CID 43539897
N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-pyrazol-4-amine (PubChem CID 43539897) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-pyrazol-4-amine.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 43539897 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1H-pyrazol-4-amine |
| SMILES | c1ccc2c(c1)CCCC2Nc1cn[nH]c1 |
| InChI | InChI=1S/C13H15N3/c1-2-6-12-10(4-1)5-3-7-13(12)16-11-8-14-15-9-11/h1-2,4,6,8-9,13,16H,3,5,7H2,(H,14,15) |
| InChIKey | JSRBXUQRLZWRKC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |