C16H22N2 — CID 97170591
N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 97170591) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 97170591 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | c1ccc2c(c1)CCC[C@@H]2NC1=NCCCCC1 |
| InChI | InChI=1S/C16H22N2/c1-2-11-16(17-12-5-1)18-15-10-6-8-13-7-3-4-9-14(13)15/h3-4,7,9,15H,1-2,5-6,8,10-12H2,(H,17,18)/t15-/m0/s1 |
| InChIKey | IZMGNSJTHGZIRM-HNNXBMFYSA-N |
| XLogP | 3.63 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |