C48H40N10O2 — CID 157306283
N-[(3-aminophenyl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-[(3-nitrophenyl)methyl]quinoxalin-6-amine (PubChem CID 157306283) has the molecular formula C48H40N10O2 and a molecular weight of 788.92 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-[(3-nitrophenyl)methyl]quinoxalin-6-amine.
| Compound Name | N-[(3-aminophenyl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-[(3-nitrophenyl)methyl]quinoxalin-6-amine |
|---|---|
| PubChem CID | 157306283 |
| Molecular Formula | C48H40N10O2 |
| Molecular Weight | 788.92 g/mol |
| Exact Mass | 788.33 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-8-(1-methylindol-6-yl)quinoxalin-6-amine;8-(1-methylindol-6-yl)-N-[(3-nitrophenyl)methyl]quinoxalin-6-amine |
| SMILES | Cn1ccc2ccc(-c3cc(NCc4cccc(N)c4)cc4nccnc34)cc21.Cn1ccc2ccc(-c3cc(NCc4cccc([N+](=O)[O-])c4)cc4nccnc34)cc21 |
| InChI | InChI=1S/C24H19N5O2.C24H21N5/c1-28-10-7-17-5-6-18(12-23(17)28)21-13-19(14-22-24(21)26-9-8-25-22)27-15-16-3-2-4-20(11-16)29(30)31;1-29-10-7-17-5-6-18(12-23(17)29)21-13-20(14-22-24(21)27-9-8-26-22)28-15-16-3-2-4-19(25)11-16/h2-14,27H,15H2,1H3;2-14,28H,15,25H2,1H3 |
| InChIKey | BCMYCVMNIOSZRP-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.92 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|