C16H18N4OS — CID 122691575
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(3-ethynylpiperidin-1-yl)methanone (PubChem CID 122691575) has the molecular formula C16H18N4OS and a molecular weight of 314.41 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(3-ethynylpiperidin-1-yl)methanone.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(3-ethynylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 122691575 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-(3-ethynylpiperidin-1-yl)methanone |
| SMILES | C#CC1CCCN(C(=O)c2sc3nnc(C)c(C)c3c2N)C1 |
| InChI | InChI=1S/C16H18N4OS/c1-4-11-6-5-7-20(8-11)16(21)14-13(17)12-9(2)10(3)18-19-15(12)22-14/h1,11H,5-8,17H2,2-3H3 |
| InChIKey | RQVQUXLRWSMBSY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|