C7H11NO — CID 122692021
2-methoxy-5-methyl-1,2-dihydropyridine (PubChem CID 122692021) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-methoxy-5-methyl-1,2-dihydropyridine.
| Compound Name | 2-methoxy-5-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 122692021 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2-methoxy-5-methyl-1,2-dihydropyridine |
| SMILES | COC1C=CC(C)=CN1 |
| InChI | InChI=1S/C7H11NO/c1-6-3-4-7(9-2)8-5-6/h3-5,7-8H,1-2H3 |
| InChIKey | DWLRGPWBLWMNEK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |