C9H10N6O2 — CID 122692069
4-amino-6-(hydrazinecarbonyl)pyrrolo[1,2-b]pyridazine-3-carboxamide (PubChem CID 122692069) has the molecular formula C9H10N6O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-amino-6-(hydrazinecarbonyl)pyrrolo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 4-amino-6-(hydrazinecarbonyl)pyrrolo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 122692069 |
| Molecular Formula | C9H10N6O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-amino-6-(hydrazinecarbonyl)pyrrolo[1,2-b]pyridazine-3-carboxamide |
| SMILES | NNC(=O)c1cc2c(N)c(C(N)=O)cnn2c1 |
| InChI | InChI=1S/C9H10N6O2/c10-7-5(8(11)16)2-13-15-3-4(1-6(7)15)9(17)14-12/h1-3H,10,12H2,(H2,11,16)(H,14,17) |
| InChIKey | PYEIKGHZZFCCTM-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 141.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|