C20H35NO — CID 122692218
(2Z)-N-(cyclopropylmethyl)-N-(1-methoxy-3-methylbut-2-enyl)-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 122692218) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is (2Z)-N-(cyclopropylmethyl)-N-(1-methoxy-3-methylbut-2-enyl)-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | (2Z)-N-(cyclopropylmethyl)-N-(1-methoxy-3-methylbut-2-enyl)-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 122692218 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | (2Z)-N-(cyclopropylmethyl)-N-(1-methoxy-3-methylbut-2-enyl)-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | COC(C=C(C)C)N(C/C=C(/C)CCC=C(C)C)CC1CC1 |
| InChI | InChI=1S/C20H35NO/c1-16(2)8-7-9-18(5)12-13-21(15-19-10-11-19)20(22-6)14-17(3)4/h8,12,14,19-20H,7,9-11,13,15H2,1-6H3/b18-12- |
| InChIKey | LMKXYHXCUQNBIF-PDGQHHTCSA-N |
| XLogP | 5.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|