C17H39NO — CID 144711890
(E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine;ethane;propane (PubChem CID 144711890) has the molecular formula C17H39NO and a molecular weight of 273.50 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine;ethane;propane.
| Compound Name | (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine;ethane;propane |
|---|---|
| PubChem CID | 144711890 |
| Molecular Formula | C17H39NO |
| Molecular Weight | 273.50 g/mol |
| Exact Mass | 273.30 |
| IUPAC Name | (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine;ethane;propane |
| SMILES | CC.CCC.CCC/C(=C\CN(CC)CC)COC |
| InChI | InChI=1S/C12H25NO.C3H8.C2H6/c1-5-8-12(11-14-4)9-10-13(6-2)7-3;1-3-2;1-2/h9H,5-8,10-11H2,1-4H3;3H2,1-2H3;1-2H3/b12-9+;; |
| InChIKey | PHFVSLDSEUNEMB-ANOGCNOSSA-N |
| XLogP | 5.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|