C12H25NO — CID 144711891
(E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine (PubChem CID 144711891) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine.
| Compound Name | (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine |
|---|---|
| PubChem CID | 144711891 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | (E)-N,N-diethyl-3-(methoxymethyl)hex-2-en-1-amine |
| SMILES | CCC/C(=C\CN(CC)CC)COC |
| InChI | InChI=1S/C12H25NO/c1-5-8-12(11-14-4)9-10-13(6-2)7-3/h9H,5-8,10-11H2,1-4H3/b12-9+ |
| InChIKey | VLRBWGBRCVCDES-FMIVXFBMSA-N |
| XLogP | 2.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|