C15H27NO2 — CID 144515537
(7E,12Z)-9-methoxy-5,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-diene (PubChem CID 144515537) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is (7E,12Z)-9-methoxy-5,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-diene.
| Compound Name | (7E,12Z)-9-methoxy-5,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-diene |
|---|---|
| PubChem CID | 144515537 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | (7E,12Z)-9-methoxy-5,13-dimethyl-1-oxa-5-azacyclotetradeca-7,12-diene |
| SMILES | COC1/C=C/CN(C)CCCOC/C(C)=C\CC1 |
| InChI | InChI=1S/C15H27NO2/c1-14-7-4-8-15(17-3)9-5-10-16(2)11-6-12-18-13-14/h5,7,9,15H,4,6,8,10-13H2,1-3H3/b9-5+,14-7- |
| InChIKey | FIPLIJGBYFUOJC-NLXGQYKLSA-N |
| XLogP | 2.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|